C22H39N3O8 — CID 54265097
2-[[2-[carboxymethyl-[2-[carboxymethyl(2-hydroperoxyethyl)amino]cyclohexyl]amino]cyclohexyl]-ethylamino]acetic acid (PubChem CID 54265097) has the molecular formula C22H39N3O8 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-[[2-[carboxymethyl-[2-[carboxymethyl(2-hydroperoxyethyl)amino]cyclohexyl]amino]cyclohexyl]-ethylamino]acetic acid.
| Compound Name | 2-[[2-[carboxymethyl-[2-[carboxymethyl(2-hydroperoxyethyl)amino]cyclohexyl]amino]cyclohexyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 54265097 |
| Molecular Formula | C22H39N3O8 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | 2-[[2-[carboxymethyl-[2-[carboxymethyl(2-hydroperoxyethyl)amino]cyclohexyl]amino]cyclohexyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCCCC1N(CC(=O)O)C1CCCCC1N(CCOO)CC(=O)O |
| InChI | InChI=1S/C22H39N3O8/c1-2-23(13-20(26)27)16-7-3-5-9-18(16)25(15-22(30)31)19-10-6-4-8-17(19)24(11-12-33-32)14-21(28)29/h16-19,32H,2-15H2,1H3,(H,26,27)(H,28,29)(H,30,31) |
| InChIKey | XCPJHSTWBPOSFR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|