C16H31N3O7 — CID 144635961
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[ethyl(2-oxoethyl)amino]ethyl]amino]acetic acid;ethane (PubChem CID 144635961) has the molecular formula C16H31N3O7 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[ethyl(2-oxoethyl)amino]ethyl]amino]acetic acid;ethane.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[ethyl(2-oxoethyl)amino]ethyl]amino]acetic acid;ethane |
|---|---|
| PubChem CID | 144635961 |
| Molecular Formula | C16H31N3O7 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[ethyl(2-oxoethyl)amino]ethyl]amino]acetic acid;ethane |
| SMILES | CC.CCN(CC=O)CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H25N3O7.C2H6/c1-2-15(7-8-18)3-4-16(9-12(19)20)5-6-17(10-13(21)22)11-14(23)24;1-2/h8H,2-7,9-11H2,1H3,(H,19,20)(H,21,22)(H,23,24);1-2H3 |
| InChIKey | LRNNUKJTZPOWRB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 138.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|