C14H24N2O8 — CID 145210953
2-[2-[2-[2-[bis(2-oxoethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 145210953) has the molecular formula C14H24N2O8 and a molecular weight of 348.35 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis(2-oxoethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[2-[bis(2-oxoethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 145210953 |
| Molecular Formula | C14H24N2O8 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[2-[2-[2-[bis(2-oxoethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=CCN(CC=O)CCOCCOCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C14H24N2O8/c17-5-1-15(2-6-18)3-7-23-9-10-24-8-4-16(11-13(19)20)12-14(21)22/h5-6H,1-4,7-12H2,(H,19,20)(H,21,22) |
| InChIKey | BOUKHTLSGWLLKQ-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|