C18H38CuNO7-3 — CID 22956668
carbanide;2-[carboxymethyl-[2-[2-[2-(2-methylbutoxy)ethoxy]ethoxy]ethyl]amino]acetic acid;copper (PubChem CID 22956668) has the molecular formula C18H38CuNO7-3 and a molecular weight of 444.05 g/mol. Its IUPAC name is carbanide;2-[carboxymethyl-[2-[2-[2-(2-methylbutoxy)ethoxy]ethoxy]ethyl]amino]acetic acid;copper.
| Compound Name | carbanide;2-[carboxymethyl-[2-[2-[2-(2-methylbutoxy)ethoxy]ethoxy]ethyl]amino]acetic acid;copper |
|---|---|
| PubChem CID | 22956668 |
| Molecular Formula | C18H38CuNO7-3 |
| Molecular Weight | 444.05 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | carbanide;2-[carboxymethyl-[2-[2-[2-(2-methylbutoxy)ethoxy]ethoxy]ethyl]amino]acetic acid;copper |
| SMILES | CCC(C)COCCOCCOCCN(CC(=O)O)CC(=O)O.[CH3-].[CH3-].[CH3-].[Cu] |
| InChI | InChI=1S/C15H29NO7.3CH3.Cu/c1-3-13(2)12-23-9-8-22-7-6-21-5-4-16(10-14(17)18)11-15(19)20;;;;/h13H,3-12H2,1-2H3,(H,17,18)(H,19,20);3*1H3;/q;3*-1; |
| InChIKey | RNSIWHAKJRJHJZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.05 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|