C15H28N2O8 — CID 152544554
2-[carboxymethyl-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]amino]acetic acid (PubChem CID 152544554) has the molecular formula C15H28N2O8 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 152544554 |
| Molecular Formula | C15H28N2O8 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[carboxymethyl-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethyl]amino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C15H28N2O8/c1-15(2,3)25-14(22)16-4-6-23-8-9-24-7-5-17(10-12(18)19)11-13(20)21/h4-11H2,1-3H3,(H,16,22)(H,18,19)(H,20,21) |
| InChIKey | YMFAYXGIADKISR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|