C40H70N6O14 — CID 10941903
benzyl N-[2-[2-[2-[bis[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 10941903) has the molecular formula C40H70N6O14 and a molecular weight of 859.03 g/mol. Its IUPAC name is benzyl N-[2-[2-[2-[bis[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[2-[bis[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 10941903 |
| Molecular Formula | C40H70N6O14 |
| Molecular Weight | 859.03 g/mol |
| Exact Mass | 858.50 |
| IUPAC Name | benzyl N-[2-[2-[2-[bis[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylamino]-2-oxoethyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)CN(CCOCCOCCNC(=O)OCc1ccccc1)CC(=O)NCCOCCOCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H70N6O14/c1-39(2,3)59-37(50)44-15-21-55-26-24-52-18-12-41-34(47)30-46(17-23-57-29-28-54-20-14-43-36(49)58-32-33-10-8-7-9-11-33)31-35(48)42-13-19-53-25-27-56-22-16-45-38(51)60-40(4,5)6/h7-11H,12-32H2,1-6H3,(H,41,47)(H,42,48)(H,43,49)(H,44,50)(H,45,51) |
| InChIKey | FAWNNFISXOOEKE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 231.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.03 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|