C20H31BrN2O7 — CID 170898622
benzyl N-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 170898622) has the molecular formula C20H31BrN2O7 and a molecular weight of 491.38 g/mol. Its IUPAC name is benzyl N-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | benzyl N-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170898622 |
| Molecular Formula | C20H31BrN2O7 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | benzyl N-[2-[2-[2-[2-[2-[(2-bromoacetyl)amino]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | O=C(CBr)NCCOCCOCCOCCOCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31BrN2O7/c21-16-19(24)22-6-8-26-10-12-28-14-15-29-13-11-27-9-7-23-20(25)30-17-18-4-2-1-3-5-18/h1-5H,6-17H2,(H,22,24)(H,23,25) |
| InChIKey | KKQZHBXZTYJYOK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|