C15H20N4O7 — CID 135285198
2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]ethoxycarbamic acid (PubChem CID 135285198) has the molecular formula C15H20N4O7 and a molecular weight of 368.35 g/mol. Its IUPAC name is 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]ethoxycarbamic acid.
| Compound Name | 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]ethoxycarbamic acid |
|---|---|
| PubChem CID | 135285198 |
| Molecular Formula | C15H20N4O7 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]ethoxycarbamic acid |
| SMILES | O=C(O)NOCCNC(=O)CNC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N4O7/c20-12(16-6-7-26-19-14(22)23)8-17-13(21)9-18-15(24)25-10-11-4-2-1-3-5-11/h1-5,19H,6-10H2,(H,16,20)(H,17,21)(H,18,24)(H,22,23) |
| InChIKey | BTKJMTSCZOSVPP-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|