C17H17FN2O3 — CID 101435256
benzyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate (PubChem CID 101435256) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is benzyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 101435256 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | benzyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O3/c18-15-8-6-13(7-9-15)10-19-16(21)11-20-17(22)23-12-14-4-2-1-3-5-14/h1-9H,10-12H2,(H,19,21)(H,20,22) |
| InChIKey | HXWRFGMBFJQRKB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |