C11H13FN2O3 — CID 47300199
methyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate (PubChem CID 47300199) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is methyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 47300199 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN2O3/c1-17-11(16)14-7-10(15)13-6-8-2-4-9(12)5-3-8/h2-5H,6-7H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | YAIKPUXQULBOOI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |