C18H20FN3O3 — CID 18159108
2-[(4-fluorophenyl)methylcarbamoylamino]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 18159108) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18159108 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)CNC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c1-25-16-5-3-2-4-14(16)11-20-17(23)12-22-18(24)21-10-13-6-8-15(19)9-7-13/h2-9H,10-12H2,1H3,(H,20,23)(H2,21,22,24) |
| InChIKey | ODCCHXBOEZWSOQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |