C24H44N2O6 — CID 146611862
1-[2-[2-[2-[bis(3-methyl-2-oxobutyl)amino]ethoxy]ethoxy]ethyl-(2-oxopropyl)amino]-3-methylbutan-2-one (PubChem CID 146611862) has the molecular formula C24H44N2O6 and a molecular weight of 456.62 g/mol. Its IUPAC name is 1-[2-[2-[2-[bis(3-methyl-2-oxobutyl)amino]ethoxy]ethoxy]ethyl-(2-oxopropyl)amino]-3-methylbutan-2-one.
| Compound Name | 1-[2-[2-[2-[bis(3-methyl-2-oxobutyl)amino]ethoxy]ethoxy]ethyl-(2-oxopropyl)amino]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 146611862 |
| Molecular Formula | C24H44N2O6 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | 1-[2-[2-[2-[bis(3-methyl-2-oxobutyl)amino]ethoxy]ethoxy]ethyl-(2-oxopropyl)amino]-3-methylbutan-2-one |
| SMILES | CC(=O)CN(CCOCCOCCN(CC(=O)C(C)C)CC(=O)C(C)C)CC(=O)C(C)C |
| InChI | InChI=1S/C24H44N2O6/c1-18(2)22(28)15-25(14-21(7)27)8-10-31-12-13-32-11-9-26(16-23(29)19(3)4)17-24(30)20(5)6/h18-20H,8-17H2,1-7H3 |
| InChIKey | CAECAWKEVNVCCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|