C21H33N5O8 — CID 163765652
2-[2-[2-[[3-(4-aminophenyl)-2-(carboxymethylamino)propyl]-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid (PubChem CID 163765652) has the molecular formula C21H33N5O8 and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-[2-[2-[[3-(4-aminophenyl)-2-(carboxymethylamino)propyl]-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[2-[[3-(4-aminophenyl)-2-(carboxymethylamino)propyl]-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 163765652 |
| Molecular Formula | C21H33N5O8 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-[2-[2-[[3-(4-aminophenyl)-2-(carboxymethylamino)propyl]-(carboxymethyl)amino]ethyl-(carboxymethyl)amino]ethylamino]acetic acid |
| SMILES | Nc1ccc(CC(CN(CCN(CCNCC(=O)O)CC(=O)O)CC(=O)O)NCC(=O)O)cc1 |
| InChI | InChI=1S/C21H33N5O8/c22-16-3-1-15(2-4-16)9-17(24-11-19(29)30)12-26(14-21(33)34)8-7-25(13-20(31)32)6-5-23-10-18(27)28/h1-4,17,23-24H,5-14,22H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | MCAPQVXLNHMLHR-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|