C23H28N4O10 — CID 173205246
2-[[(2S)-1-[carboxymethyl-[(2S)-2-(carboxymethylamino)-3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propyl]amino]propan-2-yl]amino]propanedioic acid (PubChem CID 173205246) has the molecular formula C23H28N4O10 and a molecular weight of 520.50 g/mol. Its IUPAC name is 2-[[(2S)-1-[carboxymethyl-[(2S)-2-(carboxymethylamino)-3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propyl]amino]propan-2-yl]amino]propanedioic acid.
| Compound Name | 2-[[(2S)-1-[carboxymethyl-[(2S)-2-(carboxymethylamino)-3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propyl]amino]propan-2-yl]amino]propanedioic acid |
|---|---|
| PubChem CID | 173205246 |
| Molecular Formula | C23H28N4O10 |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 2-[[(2S)-1-[carboxymethyl-[(2S)-2-(carboxymethylamino)-3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propyl]amino]propan-2-yl]amino]propanedioic acid |
| SMILES | C[C@@H](CN(CC(=O)O)C[C@H](Cc1ccc(N2C(=O)C=CC2=O)cc1)NCC(=O)O)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H28N4O10/c1-13(25-21(22(34)35)23(36)37)10-26(12-20(32)33)11-15(24-9-19(30)31)8-14-2-4-16(5-3-14)27-17(28)6-7-18(27)29/h2-7,13,15,21,24-25H,8-12H2,1H3,(H,30,31)(H,32,33)(H,34,35)(H,36,37)/t13-,15-/m0/s1 |
| InChIKey | BPMPYSPOPAOUSX-ZFWWWQNUSA-N |
| XLogP | -1.40 |
| TPSA | 213.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|