C28H35N5O13 — CID 66686967
2-[1-[[2-[bis(carboxymethyl)amino]-3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]propyl]-(carboxymethyl)amino]propan-2-ylamino]propanedioic acid (PubChem CID 66686967) has the molecular formula C28H35N5O13 and a molecular weight of 649.61 g/mol. Its IUPAC name is 2-[1-[[2-[bis(carboxymethyl)amino]-3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]propyl]-(carboxymethyl)amino]propan-2-ylamino]propanedioic acid.
| Compound Name | 2-[1-[[2-[bis(carboxymethyl)amino]-3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]propyl]-(carboxymethyl)amino]propan-2-ylamino]propanedioic acid |
|---|---|
| PubChem CID | 66686967 |
| Molecular Formula | C28H35N5O13 |
| Molecular Weight | 649.61 g/mol |
| Exact Mass | 649.22 |
| IUPAC Name | 2-[1-[[2-[bis(carboxymethyl)amino]-3-[4-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]phenyl]propyl]-(carboxymethyl)amino]propan-2-ylamino]propanedioic acid |
| SMILES | CC(CN(CC(=O)O)CC(Cc1ccc(NC(=O)CCN2C(=O)C=CC2=O)cc1)N(CC(=O)O)CC(=O)O)NC(C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H35N5O13/c1-16(29-26(27(43)44)28(45)46)11-31(13-23(37)38)12-19(32(14-24(39)40)15-25(41)42)10-17-2-4-18(5-3-17)30-20(34)8-9-33-21(35)6-7-22(33)36/h2-7,16,19,26,29H,8-15H2,1H3,(H,30,34)(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H,45,46) |
| InChIKey | ZSIBWAHUXDCWKE-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 271.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.61 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|