C27H34N4O11 — CID 15639916
2-[[2-[bis(carboxymethyl)amino]-3-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]propyl]-(carboxymethyl)amino]acetic acid (PubChem CID 15639916) has the molecular formula C27H34N4O11 and a molecular weight of 590.59 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-3-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]propyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-3-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]propyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 15639916 |
| Molecular Formula | C27H34N4O11 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-3-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]propyl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(Cc1ccc(NC(=O)CCCCCN2C(=O)C=CC2=O)cc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C27H34N4O11/c32-21(4-2-1-3-11-31-22(33)9-10-23(31)34)28-19-7-5-18(6-8-19)12-20(30(16-26(39)40)17-27(41)42)13-29(14-24(35)36)15-25(37)38/h5-10,20H,1-4,11-17H2,(H,28,32)(H,35,36)(H,37,38)(H,39,40)(H,41,42) |
| InChIKey | YKVXWWYFEUPZKJ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 222.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|