C33H35N5O11 — CID 25031094
2-[[6-[[bis(carboxymethyl)amino]methyl]-4-[2-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]ethynyl]-2-pyridinyl]methyl-(carboxymethyl)amino]acetic acid (PubChem CID 25031094) has the molecular formula C33H35N5O11 and a molecular weight of 677.67 g/mol. Its IUPAC name is 2-[[6-[[bis(carboxymethyl)amino]methyl]-4-[2-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]ethynyl]-2-pyridinyl]methyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[6-[[bis(carboxymethyl)amino]methyl]-4-[2-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]ethynyl]-2-pyridinyl]methyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 25031094 |
| Molecular Formula | C33H35N5O11 |
| Molecular Weight | 677.67 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | 2-[[6-[[bis(carboxymethyl)amino]methyl]-4-[2-[4-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]ethynyl]-2-pyridinyl]methyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)Cc1cc(C#Cc2ccc(NC(=O)CCCCCN3C(=O)C=CC3=O)cc2)cc(CN(CC(=O)O)CC(=O)O)n1 |
| InChI | InChI=1S/C33H35N5O11/c39-27(4-2-1-3-13-38-28(40)11-12-29(38)41)35-24-9-7-22(8-10-24)5-6-23-14-25(16-36(18-30(42)43)19-31(44)45)34-26(15-23)17-37(20-32(46)47)21-33(48)49/h7-12,14-15H,1-4,13,16-21H2,(H,35,39)(H,42,43)(H,44,45)(H,46,47)(H,48,49) |
| InChIKey | LFUVXVODNLNUBL-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 235.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.67 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|