C18H21N3O6 — CID 171802233
[3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-hydroxyphenyl]methyl carbamate (PubChem CID 171802233) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is [3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-hydroxyphenyl]methyl carbamate.
| Compound Name | [3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-hydroxyphenyl]methyl carbamate |
|---|---|
| PubChem CID | 171802233 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-hydroxyphenyl]methyl carbamate |
| SMILES | NC(=O)OCc1ccc(O)c(NC(=O)CCCCCN2C(=O)C=CC2=O)c1 |
| InChI | InChI=1S/C18H21N3O6/c19-18(26)27-11-12-5-6-14(22)13(10-12)20-15(23)4-2-1-3-9-21-16(24)7-8-17(21)25/h5-8,10,22H,1-4,9,11H2,(H2,19,26)(H,20,23) |
| InChIKey | XAMZZFOWMLBPFS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|