C25H35N5O7 — CID 163652120
[4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1-hydroxy-3-methylbutyl]amino]acetyl]amino]phenyl]methyl carbamate (PubChem CID 163652120) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1-hydroxy-3-methylbutyl]amino]acetyl]amino]phenyl]methyl carbamate.
| Compound Name | [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1-hydroxy-3-methylbutyl]amino]acetyl]amino]phenyl]methyl carbamate |
|---|---|
| PubChem CID | 163652120 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | [4-[[2-[[(2S)-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-1-hydroxy-3-methylbutyl]amino]acetyl]amino]phenyl]methyl carbamate |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(O)NCC(=O)Nc1ccc(COC(N)=O)cc1 |
| InChI | InChI=1S/C25H35N5O7/c1-16(2)23(29-19(31)6-4-3-5-13-30-21(33)11-12-22(30)34)24(35)27-14-20(32)28-18-9-7-17(8-10-18)15-37-25(26)36/h7-12,16,23-24,27,35H,3-6,13-15H2,1-2H3,(H2,26,36)(H,28,32)(H,29,31)/t23-,24?/m0/s1 |
| InChIKey | INBMUZUKAWDILB-UXMRNZNESA-N |
| XLogP | 0.75 |
| TPSA | 180.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|