C23H31IN4O9S — CID 163276122
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-(2-iodo-2-oxoethyl)amino]-3-[4-(ethanethioylamino)phenyl]propyl]amino]acetic acid (PubChem CID 163276122) has the molecular formula C23H31IN4O9S and a molecular weight of 666.49 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-(2-iodo-2-oxoethyl)amino]-3-[4-(ethanethioylamino)phenyl]propyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-(2-iodo-2-oxoethyl)amino]-3-[4-(ethanethioylamino)phenyl]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 163276122 |
| Molecular Formula | C23H31IN4O9S |
| Molecular Weight | 666.49 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-(2-iodo-2-oxoethyl)amino]-3-[4-(ethanethioylamino)phenyl]propyl]amino]acetic acid |
| SMILES | CC(=S)Nc1ccc(CC(CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)I)cc1 |
| InChI | InChI=1S/C23H31IN4O9S/c1-15(38)25-17-4-2-16(3-5-17)8-18(28(10-19(24)29)14-23(36)37)9-26(11-20(30)31)6-7-27(12-21(32)33)13-22(34)35/h2-5,18H,6-14H2,1H3,(H,25,38)(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | AOFJLWLIEPCGEM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 188.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.49 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|