C22H30N4O12 — CID 12069904
2-[[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]-[3-[bis(carboxymethyl)amino]propyl]amino]acetic acid (PubChem CID 12069904) has the molecular formula C22H30N4O12 and a molecular weight of 542.50 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]-[3-[bis(carboxymethyl)amino]propyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]-[3-[bis(carboxymethyl)amino]propyl]amino]acetic acid |
|---|---|
| PubChem CID | 12069904 |
| Molecular Formula | C22H30N4O12 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propyl]-[3-[bis(carboxymethyl)amino]propyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCCN(CC(=O)O)CC(Cc1ccc([N+](=O)[O-])cc1)N(CC(=O)O)CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C22H30N4O12/c27-18(28)10-23(6-1-7-24(11-19(29)30)12-20(31)32)9-17(25(13-21(33)34)14-22(35)36)8-15-2-4-16(5-3-15)26(37)38/h2-5,17H,1,6-14H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | IQLFTYJZLHQVBB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 239.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|