C16H19N3O10 — CID 129388625
2-[[(2S)-2-[bis(carboxymethyl)amino]-2-(4-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 129388625) has the molecular formula C16H19N3O10 and a molecular weight of 413.34 g/mol. Its IUPAC name is 2-[[(2S)-2-[bis(carboxymethyl)amino]-2-(4-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[(2S)-2-[bis(carboxymethyl)amino]-2-(4-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 129388625 |
| Molecular Formula | C16H19N3O10 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[[(2S)-2-[bis(carboxymethyl)amino]-2-(4-nitrophenyl)ethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C[C@H](c1ccc([N+](=O)[O-])cc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H19N3O10/c20-13(21)6-17(7-14(22)23)5-12(18(8-15(24)25)9-16(26)27)10-1-3-11(4-2-10)19(28)29/h1-4,12H,5-9H2,(H,20,21)(H,22,23)(H,24,25)(H,26,27)/t12-/m1/s1 |
| InChIKey | MTDTZVMJXGZJCG-GFCCVEGCSA-N |
| XLogP | -0.42 |
| TPSA | 198.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|