C16H20N2O8 — CID 14550244
2-[[2-[bis(carboxymethyl)amino]-2-phenylethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 14550244) has the molecular formula C16H20N2O8 and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-2-phenylethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-2-phenylethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 14550244 |
| Molecular Formula | C16H20N2O8 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-2-phenylethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)CC(c1ccccc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H20N2O8/c19-13(20)7-17(8-14(21)22)6-12(11-4-2-1-3-5-11)18(9-15(23)24)10-16(25)26/h1-5,12H,6-10H2,(H,19,20)(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | VAENCWBQUNKRKC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |