C21H26N4O10S — CID 58113772
2-[[2-[bis(carboxymethyl)amino]-2-(4-isothiocyanatophenyl)ethyl]-[2-[bis(formyloxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 58113772) has the molecular formula C21H26N4O10S and a molecular weight of 526.52 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-2-(4-isothiocyanatophenyl)ethyl]-[2-[bis(formyloxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-2-(4-isothiocyanatophenyl)ethyl]-[2-[bis(formyloxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 58113772 |
| Molecular Formula | C21H26N4O10S |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-2-(4-isothiocyanatophenyl)ethyl]-[2-[bis(formyloxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | O=COCN(CCN(CC(=O)O)CC(c1ccc(N=C=S)cc1)N(CC(=O)O)CC(=O)O)COC=O |
| InChI | InChI=1S/C21H26N4O10S/c26-14-34-12-24(13-35-15-27)6-5-23(8-19(28)29)7-18(25(9-20(30)31)10-21(32)33)16-1-3-17(4-2-16)22-11-36/h1-4,14-15,18H,5-10,12-13H2,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | GFGUEWGCQVKIGY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|