C18H21N3O8S — CID 18421191
2-[carboxymethyl-[2-[carboxymethyl-[2-[(4-isothiocyanatophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 18421191) has the molecular formula C18H21N3O8S and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-[carboxymethyl-[2-[(4-isothiocyanatophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-[(4-isothiocyanatophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 18421191 |
| Molecular Formula | C18H21N3O8S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-[carboxymethyl-[2-[carboxymethyl-[2-[(4-isothiocyanatophenyl)methoxy]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)OCc1ccc(N=C=S)cc1)CC(=O)O |
| InChI | InChI=1S/C18H21N3O8S/c22-15(23)7-20(8-16(24)25)5-6-21(9-17(26)27)10-18(28)29-11-13-1-3-14(4-2-13)19-12-30/h1-4H,5-11H2,(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | LNRMGEYJYKFEAQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|