C22H29N4O10S+ — CID 54572416
2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)-[2-(carboxymethylamino)-3-(4-isothiocyanatophenyl)propyl]azanium (PubChem CID 54572416) has the molecular formula C22H29N4O10S+ and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)-[2-(carboxymethylamino)-3-(4-isothiocyanatophenyl)propyl]azanium.
| Compound Name | 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)-[2-(carboxymethylamino)-3-(4-isothiocyanatophenyl)propyl]azanium |
|---|---|
| PubChem CID | 54572416 |
| Molecular Formula | C22H29N4O10S+ |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]ethyl-bis(carboxymethyl)-[2-(carboxymethylamino)-3-(4-isothiocyanatophenyl)propyl]azanium |
| SMILES | O=C(O)CNC(Cc1ccc(N=C=S)cc1)C[N+](CCN(CC(=O)O)CC(=O)O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C22H28N4O10S/c27-18(28)8-23-17(7-15-1-3-16(4-2-15)24-14-37)11-26(12-21(33)34,13-22(35)36)6-5-25(9-19(29)30)10-20(31)32/h1-4,17,23H,5-13H2,(H4-,27,28,29,30,31,32,33,34,35,36)/p+1 |
| InChIKey | YFLXNTVDWAWPJS-UHFFFAOYSA-O |
| XLogP | -0.54 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|