C28H31N7O8S2 — CID 101392763
2-[bis[2-[carboxy-[2-[(4-isothiocyanatophenyl)methylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 101392763) has the molecular formula C28H31N7O8S2 and a molecular weight of 657.73 g/mol. Its IUPAC name is 2-[bis[2-[carboxy-[2-[(4-isothiocyanatophenyl)methylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxy-[2-[(4-isothiocyanatophenyl)methylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 101392763 |
| Molecular Formula | C28H31N7O8S2 |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.17 |
| IUPAC Name | 2-[bis[2-[carboxy-[2-[(4-isothiocyanatophenyl)methylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)NCc1ccc(N=C=S)cc1)C(=O)O)CCN(CC(=O)NCc1ccc(N=C=S)cc1)C(=O)O |
| InChI | InChI=1S/C28H31N7O8S2/c36-24(29-13-20-1-5-22(6-2-20)31-18-44)15-34(27(40)41)11-9-33(17-26(38)39)10-12-35(28(42)43)16-25(37)30-14-21-3-7-23(8-4-21)32-19-45/h1-8H,9-17H2,(H,29,36)(H,30,37)(H,38,39)(H,40,41)(H,42,43) |
| InChIKey | PZUVOHRDHFTQSZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 204.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|