C26H26N4O8S2 — CID 142676262
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)-2-[(4-isothiocyanatophenyl)methyl]propanoic acid (PubChem CID 142676262) has the molecular formula C26H26N4O8S2 and a molecular weight of 586.65 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)-2-[(4-isothiocyanatophenyl)methyl]propanoic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)-2-[(4-isothiocyanatophenyl)methyl]propanoic acid |
|---|---|
| PubChem CID | 142676262 |
| Molecular Formula | C26H26N4O8S2 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)-2-[(4-isothiocyanatophenyl)methyl]propanoic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)(Cc1ccc(N=C=S)cc1)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C26H26N4O8S2/c31-22(32)13-29(14-23(33)34)9-10-30(15-24(35)36)26(25(37)38,11-18-1-5-20(6-2-18)27-16-39)12-19-3-7-21(8-4-19)28-17-40/h1-8H,9-15H2,(H,31,32)(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | PQYFRWCKRASLJV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|