C19H24ClN3O9 — CID 68869158
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid (PubChem CID 68869158) has the molecular formula C19H24ClN3O9 and a molecular weight of 473.87 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 68869158 |
| Molecular Formula | C19H24ClN3O9 |
| Molecular Weight | 473.87 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]-2-[(2-chloroacetyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)C(Cc1ccccc1)(NC(=O)CCl)C(=O)O)CC(=O)O |
| InChI | InChI=1S/C19H24ClN3O9/c20-9-14(24)21-19(18(31)32,8-13-4-2-1-3-5-13)23(12-17(29)30)7-6-22(10-15(25)26)11-16(27)28/h1-5H,6-12H2,(H,21,24)(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | BPGIMKBGBRBELC-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 184.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.87 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|