C21H22Cl2O4 — CID 174405810
2,2-dibenzyl-3-methylidenepentanedioic acid;dichloromethane (PubChem CID 174405810) has the molecular formula C21H22Cl2O4 and a molecular weight of 409.31 g/mol. Its IUPAC name is 2,2-dibenzyl-3-methylidenepentanedioic acid;dichloromethane.
| Compound Name | 2,2-dibenzyl-3-methylidenepentanedioic acid;dichloromethane |
|---|---|
| PubChem CID | 174405810 |
| Molecular Formula | C21H22Cl2O4 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2,2-dibenzyl-3-methylidenepentanedioic acid;dichloromethane |
| SMILES | C=C(CC(=O)O)C(Cc1ccccc1)(Cc1ccccc1)C(=O)O.ClCCl |
| InChI | InChI=1S/C20H20O4.CH2Cl2/c1-15(12-18(21)22)20(19(23)24,13-16-8-4-2-5-9-16)14-17-10-6-3-7-11-17;2-1-3/h2-11H,1,12-14H2,(H,21,22)(H,23,24);1H2 |
| InChIKey | QYDVVINMWXUIFD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|