C21H20O5 — CID 22289507
2-benzyl-3-methylidene-2-[2-(4-methylphenyl)-2-oxoethyl]butanedioic acid (PubChem CID 22289507) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-benzyl-3-methylidene-2-[2-(4-methylphenyl)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-benzyl-3-methylidene-2-[2-(4-methylphenyl)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 22289507 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-benzyl-3-methylidene-2-[2-(4-methylphenyl)-2-oxoethyl]butanedioic acid |
| SMILES | C=C(C(=O)O)C(CC(=O)c1ccc(C)cc1)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H20O5/c1-14-8-10-17(11-9-14)18(22)13-21(20(25)26,15(2)19(23)24)12-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | VYIXETJDXWOXAK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|