C20H19FO5 — CID 22133230
2-benzyl-2-ethoxycarbonyl-4-(4-fluorophenyl)-4-oxobutanoic acid (PubChem CID 22133230) has the molecular formula C20H19FO5 and a molecular weight of 358.37 g/mol. Its IUPAC name is 2-benzyl-2-ethoxycarbonyl-4-(4-fluorophenyl)-4-oxobutanoic acid.
| Compound Name | 2-benzyl-2-ethoxycarbonyl-4-(4-fluorophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22133230 |
| Molecular Formula | C20H19FO5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-benzyl-2-ethoxycarbonyl-4-(4-fluorophenyl)-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)c1ccc(F)cc1)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H19FO5/c1-2-26-19(25)20(18(23)24,12-14-6-4-3-5-7-14)13-17(22)15-8-10-16(21)11-9-15/h3-11H,2,12-13H2,1H3,(H,23,24) |
| InChIKey | XQFUJCBHFJJCEZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|