C20H26O7 — CID 50916041
triethyl 1-benzyl-3-oxobutane-1,1,4-tricarboxylate (PubChem CID 50916041) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is triethyl 1-benzyl-3-oxobutane-1,1,4-tricarboxylate.
| Compound Name | triethyl 1-benzyl-3-oxobutane-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 50916041 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | triethyl 1-benzyl-3-oxobutane-1,1,4-tricarboxylate |
| SMILES | CCOC(=O)CC(=O)CC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H26O7/c1-4-25-17(22)12-16(21)14-20(18(23)26-5-2,19(24)27-6-3)13-15-10-8-7-9-11-15/h7-11H,4-6,12-14H2,1-3H3 |
| InChIKey | JJXYIQUBGICHPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|