C19H29NO4 — CID 10947657
diethyl 2-benzyl-2-[3-(dimethylamino)propyl]propanedioate (PubChem CID 10947657) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is diethyl 2-benzyl-2-[3-(dimethylamino)propyl]propanedioate.
| Compound Name | diethyl 2-benzyl-2-[3-(dimethylamino)propyl]propanedioate |
|---|---|
| PubChem CID | 10947657 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | diethyl 2-benzyl-2-[3-(dimethylamino)propyl]propanedioate |
| SMILES | CCOC(=O)C(CCCN(C)C)(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C19H29NO4/c1-5-23-17(21)19(18(22)24-6-2,13-10-14-20(3)4)15-16-11-8-7-9-12-16/h7-9,11-12H,5-6,10,13-15H2,1-4H3 |
| InChIKey | QTLQMIILOLYYGA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|