C19H29NO5 — CID 11759916
diethyl 2-[2-(dimethylamino)ethyl]-2-[(4-methoxyphenyl)methyl]propanedioate (PubChem CID 11759916) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is diethyl 2-[2-(dimethylamino)ethyl]-2-[(4-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[2-(dimethylamino)ethyl]-2-[(4-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 11759916 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | diethyl 2-[2-(dimethylamino)ethyl]-2-[(4-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(CCN(C)C)(Cc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H29NO5/c1-6-24-17(21)19(12-13-20(3)4,18(22)25-7-2)14-15-8-10-16(23-5)11-9-15/h8-11H,6-7,12-14H2,1-5H3 |
| InChIKey | XKTLKECRMSPBKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|