C29H28O4 — CID 135347063
diethyl 2,2-bis(naphthalen-2-ylmethyl)propanedioate (PubChem CID 135347063) has the molecular formula C29H28O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is diethyl 2,2-bis(naphthalen-2-ylmethyl)propanedioate.
| Compound Name | diethyl 2,2-bis(naphthalen-2-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 135347063 |
| Molecular Formula | C29H28O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | diethyl 2,2-bis(naphthalen-2-ylmethyl)propanedioate |
| SMILES | CCOC(=O)C(Cc1ccc2ccccc2c1)(Cc1ccc2ccccc2c1)C(=O)OCC |
| InChI | InChI=1S/C29H28O4/c1-3-32-27(30)29(28(31)33-4-2,19-21-13-15-23-9-5-7-11-25(23)17-21)20-22-14-16-24-10-6-8-12-26(24)18-22/h5-18H,3-4,19-20H2,1-2H3 |
| InChIKey | MGTKUXKOXKBHIE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|