C18H24O6 — CID 68578993
3-[(3,4-dimethylphenyl)methyl]-4-ethoxy-3-ethoxycarbonyl-4-oxobutanoic acid (PubChem CID 68578993) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)methyl]-4-ethoxy-3-ethoxycarbonyl-4-oxobutanoic acid.
| Compound Name | 3-[(3,4-dimethylphenyl)methyl]-4-ethoxy-3-ethoxycarbonyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 68578993 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)methyl]-4-ethoxy-3-ethoxycarbonyl-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(CC(=O)O)(Cc1ccc(C)c(C)c1)C(=O)OCC |
| InChI | InChI=1S/C18H24O6/c1-5-23-16(21)18(11-15(19)20,17(22)24-6-2)10-14-8-7-12(3)13(4)9-14/h7-9H,5-6,10-11H2,1-4H3,(H,19,20) |
| InChIKey | SMZBQGSVMIVQJO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|