C15H18BrFO4 — CID 103974156
2-[(3-bromo-4-fluorophenyl)methyl]-2-ethoxycarbonylpentanoic acid (PubChem CID 103974156) has the molecular formula C15H18BrFO4 and a molecular weight of 361.21 g/mol. Its IUPAC name is 2-[(3-bromo-4-fluorophenyl)methyl]-2-ethoxycarbonylpentanoic acid.
| Compound Name | 2-[(3-bromo-4-fluorophenyl)methyl]-2-ethoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 103974156 |
| Molecular Formula | C15H18BrFO4 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[(3-bromo-4-fluorophenyl)methyl]-2-ethoxycarbonylpentanoic acid |
| SMILES | CCCC(Cc1ccc(F)c(Br)c1)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C15H18BrFO4/c1-3-7-15(13(18)19,14(20)21-4-2)9-10-5-6-12(17)11(16)8-10/h5-6,8H,3-4,7,9H2,1-2H3,(H,18,19) |
| InChIKey | POJAEPHLJBHQMX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|