C17H21NO2 — CID 134918284
methyl (2R)-2-amino-3-methyl-2-(naphthalen-2-ylmethyl)butanoate (PubChem CID 134918284) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is methyl (2R)-2-amino-3-methyl-2-(naphthalen-2-ylmethyl)butanoate.
| Compound Name | methyl (2R)-2-amino-3-methyl-2-(naphthalen-2-ylmethyl)butanoate |
|---|---|
| PubChem CID | 134918284 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | methyl (2R)-2-amino-3-methyl-2-(naphthalen-2-ylmethyl)butanoate |
| SMILES | COC(=O)[C@@](N)(Cc1ccc2ccccc2c1)C(C)C |
| InChI | InChI=1S/C17H21NO2/c1-12(2)17(18,16(19)20-3)11-13-8-9-14-6-4-5-7-15(14)10-13/h4-10,12H,11,18H2,1-3H3/t17-/m1/s1 |
| InChIKey | DPSGITXVPOXWSF-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |