C18H23NO4 — CID 102217783
methyl (2R)-2-amino-4,4-dimethoxy-2-(naphthalen-2-ylmethyl)butanoate (PubChem CID 102217783) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl (2R)-2-amino-4,4-dimethoxy-2-(naphthalen-2-ylmethyl)butanoate.
| Compound Name | methyl (2R)-2-amino-4,4-dimethoxy-2-(naphthalen-2-ylmethyl)butanoate |
|---|---|
| PubChem CID | 102217783 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl (2R)-2-amino-4,4-dimethoxy-2-(naphthalen-2-ylmethyl)butanoate |
| SMILES | COC(=O)[C@@](N)(Cc1ccc2ccccc2c1)CC(OC)OC |
| InChI | InChI=1S/C18H23NO4/c1-21-16(22-2)12-18(19,17(20)23-3)11-13-8-9-14-6-4-5-7-15(14)10-13/h4-10,16H,11-12,19H2,1-3H3/t18-/m1/s1 |
| InChIKey | QCKHGPMIBQELPP-GOSISDBHSA-N |
| XLogP | 2.26 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|