C17H21ClN2O2 — CID 174453601
2-amino-2-(naphthalen-2-ylmethyl)-3-oxohexanamide;hydrochloride (PubChem CID 174453601) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-amino-2-(naphthalen-2-ylmethyl)-3-oxohexanamide;hydrochloride.
| Compound Name | 2-amino-2-(naphthalen-2-ylmethyl)-3-oxohexanamide;hydrochloride |
|---|---|
| PubChem CID | 174453601 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-amino-2-(naphthalen-2-ylmethyl)-3-oxohexanamide;hydrochloride |
| SMILES | CCCC(=O)C(N)(Cc1ccc2ccccc2c1)C(N)=O.Cl |
| InChI | InChI=1S/C17H20N2O2.ClH/c1-2-5-15(20)17(19,16(18)21)11-12-8-9-13-6-3-4-7-14(13)10-12;/h3-4,6-10H,2,5,11,19H2,1H3,(H2,18,21);1H |
| InChIKey | WCKDVWRTGUQBJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|