C18H23N5O2 — CID 152752799
(2R)-2-amino-5-(diaminomethylideneamino)-2-(2-naphthalen-2-ylacetyl)pentanamide (PubChem CID 152752799) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)-2-(2-naphthalen-2-ylacetyl)pentanamide.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)-2-(2-naphthalen-2-ylacetyl)pentanamide |
|---|---|
| PubChem CID | 152752799 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)-2-(2-naphthalen-2-ylacetyl)pentanamide |
| SMILES | NC(=O)[C@@](N)(CCCN=C(N)N)C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H23N5O2/c19-16(25)18(22,8-3-9-23-17(20)21)15(24)11-12-6-7-13-4-1-2-5-14(13)10-12/h1-2,4-7,10H,3,8-9,11,22H2,(H2,19,25)(H4,20,21,23)/t18-/m1/s1 |
| InChIKey | YWQASTGHBMPEGR-GOSISDBHSA-N |
| XLogP | 0.19 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|