C19H25N3 — CID 177001574
2-[5-(naphthalen-2-ylmethyl)hept-6-enyl]guanidine (PubChem CID 177001574) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[5-(naphthalen-2-ylmethyl)hept-6-enyl]guanidine.
| Compound Name | 2-[5-(naphthalen-2-ylmethyl)hept-6-enyl]guanidine |
|---|---|
| PubChem CID | 177001574 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-[5-(naphthalen-2-ylmethyl)hept-6-enyl]guanidine |
| SMILES | C=CC(CCCCN=C(N)N)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H25N3/c1-2-15(7-5-6-12-22-19(20)21)13-16-10-11-17-8-3-4-9-18(17)14-16/h2-4,8-11,14-15H,1,5-7,12-13H2,(H4,20,21,22) |
| InChIKey | DRVQGURKWSDDDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|