C37H44N6O2 — CID 143412473
2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-5-but-3-enyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine (PubChem CID 143412473) has the molecular formula C37H44N6O2 and a molecular weight of 604.80 g/mol. Its IUPAC name is 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-5-but-3-enyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-5-but-3-enyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 143412473 |
| Molecular Formula | C37H44N6O2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-5-but-3-enyl-4-(2-naphthalen-2-ylacetyl)piperazin-2-yl]propyl]guanidine |
| SMILES | C=CCCC1CN(C(=O)[C@H](N)Cc2ccc3ccccc3c2)C(CCCN=C(N)N)CN1C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H44N6O2/c1-2-3-13-32-25-43(36(45)34(38)22-26-15-17-28-9-4-6-11-30(28)20-26)33(14-8-19-41-37(39)40)24-42(32)35(44)23-27-16-18-29-10-5-7-12-31(29)21-27/h2,4-7,9-12,15-18,20-21,32-34H,1,3,8,13-14,19,22-25,38H2,(H4,39,40,41)/t32?,33?,34-/m1/s1 |
| InChIKey | NNWSTTKDALJKOD-NGYOKKRJSA-N |
| XLogP | 4.53 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|