C36H45N7O4S — CID 67245929
2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-4-[(2R)-2-(methanesulfonamido)-3-naphthalen-2-ylpropanoyl]-5-methylpiperazin-2-yl]propyl]guanidine (PubChem CID 67245929) has the molecular formula C36H45N7O4S and a molecular weight of 671.87 g/mol. Its IUPAC name is 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-4-[(2R)-2-(methanesulfonamido)-3-naphthalen-2-ylpropanoyl]-5-methylpiperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-4-[(2R)-2-(methanesulfonamido)-3-naphthalen-2-ylpropanoyl]-5-methylpiperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 67245929 |
| Molecular Formula | C36H45N7O4S |
| Molecular Weight | 671.87 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 2-[3-[1-[(2R)-2-amino-3-naphthalen-2-ylpropanoyl]-4-[(2R)-2-(methanesulfonamido)-3-naphthalen-2-ylpropanoyl]-5-methylpiperazin-2-yl]propyl]guanidine |
| SMILES | CC1CN(C(=O)[C@H](N)Cc2ccc3ccccc3c2)C(CCCN=C(N)N)CN1C(=O)[C@@H](Cc1ccc2ccccc2c1)NS(C)(=O)=O |
| InChI | InChI=1S/C36H45N7O4S/c1-24-22-43(34(44)32(37)20-25-13-15-27-8-3-5-10-29(27)18-25)31(12-7-17-40-36(38)39)23-42(24)35(45)33(41-48(2,46)47)21-26-14-16-28-9-4-6-11-30(28)19-26/h3-6,8-11,13-16,18-19,24,31-33,41H,7,12,17,20-23,37H2,1-2H3,(H4,38,39,40)/t24?,31?,32-,33-/m1/s1 |
| InChIKey | KCVHSIOBXNKVGH-YQFBMZHUSA-N |
| XLogP | 2.50 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|