C32H43ClN6O — CID 142966122
2-[3-[1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine (PubChem CID 142966122) has the molecular formula C32H43ClN6O and a molecular weight of 563.19 g/mol. Its IUPAC name is 2-[3-[1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 142966122 |
| Molecular Formula | C32H43ClN6O |
| Molecular Weight | 563.19 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | 2-[3-[1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
| SMILES | CC(C)N[C@H](Cc1ccc(Cl)cc1)C(=O)N1CCN(CCc2ccc3ccccc3c2)CC1CCCN=C(N)N |
| InChI | InChI=1S/C32H43ClN6O/c1-23(2)37-30(21-24-10-13-28(33)14-11-24)31(40)39-19-18-38(22-29(39)8-5-16-36-32(34)35)17-15-25-9-12-26-6-3-4-7-27(26)20-25/h3-4,6-7,9-14,20,23,29-30,37H,5,8,15-19,21-22H2,1-2H3,(H4,34,35,36)/t29?,30-/m1/s1 |
| InChIKey | VAWHIANSGKEAOG-BDCODIICSA-N |
| XLogP | 4.21 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|