C29H36Cl2N6O — CID 143900773
2-[3-[1-[(2R)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine (PubChem CID 143900773) has the molecular formula C29H36Cl2N6O and a molecular weight of 555.55 g/mol. Its IUPAC name is 2-[3-[1-[(2R)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[1-[(2R)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 143900773 |
| Molecular Formula | C29H36Cl2N6O |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-[3-[1-[(2R)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCC1CN(CCc2ccc3ccccc3c2)CCN1C(=O)[C@H](N)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H36Cl2N6O/c30-24-10-9-23(26(31)18-24)17-27(32)28(38)37-15-14-36(19-25(37)6-3-12-35-29(33)34)13-11-20-7-8-21-4-1-2-5-22(21)16-20/h1-2,4-5,7-10,16,18,25,27H,3,6,11-15,17,19,32H2,(H4,33,34,35)/t25?,27-/m1/s1 |
| InChIKey | UPBOVMLAULIPGR-ZCJYOONXSA-N |
| XLogP | 3.83 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|