C29H34Cl2N6O3 — CID 11365290
2-[3-[(2S)-1-[(2S)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-yloxyethyl)-3-oxopiperazin-2-yl]propyl]guanidine (PubChem CID 11365290) has the molecular formula C29H34Cl2N6O3 and a molecular weight of 585.54 g/mol. Its IUPAC name is 2-[3-[(2S)-1-[(2S)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-yloxyethyl)-3-oxopiperazin-2-yl]propyl]guanidine.
| Compound Name | 2-[3-[(2S)-1-[(2S)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-yloxyethyl)-3-oxopiperazin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 11365290 |
| Molecular Formula | C29H34Cl2N6O3 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 2-[3-[(2S)-1-[(2S)-2-amino-3-(2,4-dichlorophenyl)propanoyl]-4-(2-naphthalen-2-yloxyethyl)-3-oxopiperazin-2-yl]propyl]guanidine |
| SMILES | NC(N)=NCCC[C@H]1C(=O)N(CCOc2ccc3ccccc3c2)CCN1C(=O)[C@@H](N)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H34Cl2N6O3/c30-22-9-7-21(24(31)18-22)17-25(32)27(38)37-13-12-36(28(39)26(37)6-3-11-35-29(33)34)14-15-40-23-10-8-19-4-1-2-5-20(19)16-23/h1-2,4-5,7-10,16,18,25-26H,3,6,11-15,17,32H2,(H4,33,34,35)/t25-,26-/m0/s1 |
| InChIKey | GQRDJCHMXARFOT-UIOOFZCWSA-N |
| XLogP | 3.19 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|