C34H49ClN6O — CID 158887508
2-[3-[(2S,5R)-1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine;methane (PubChem CID 158887508) has the molecular formula C34H49ClN6O and a molecular weight of 593.26 g/mol. Its IUPAC name is 2-[3-[(2S,5R)-1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine;methane.
| Compound Name | 2-[3-[(2S,5R)-1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine;methane |
|---|---|
| PubChem CID | 158887508 |
| Molecular Formula | C34H49ClN6O |
| Molecular Weight | 593.26 g/mol |
| Exact Mass | 592.37 |
| IUPAC Name | 2-[3-[(2S,5R)-1-[(2R)-3-(4-chlorophenyl)-2-(propan-2-ylamino)propanoyl]-5-methyl-4-(2-naphthalen-2-ylethyl)piperazin-2-yl]propyl]guanidine;methane |
| SMILES | C.CC(C)N[C@H](Cc1ccc(Cl)cc1)C(=O)N1C[C@@H](C)N(CCc2ccc3ccccc3c2)C[C@@H]1CCCN=C(N)N |
| InChI | InChI=1S/C33H45ClN6O.CH4/c1-23(2)38-31(20-25-11-14-29(34)15-12-25)32(41)40-21-24(3)39(22-30(40)9-6-17-37-33(35)36)18-16-26-10-13-27-7-4-5-8-28(27)19-26;/h4-5,7-8,10-15,19,23-24,30-31,38H,6,9,16-18,20-22H2,1-3H3,(H4,35,36,37);1H4/t24-,30+,31-;/m1./s1 |
| InChIKey | JDUXPWYRIKVDAL-RSXPFTBHSA-N |
| XLogP | 5.24 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|