C38H43FN6O4 — CID 142686007
4-[2-[3-(diaminomethylideneamino)propyl]-4-(2-naphthalen-2-ylethyl)-5-oxopiperazin-1-yl]-3-[(4-fluorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-4-oxobutanamide (PubChem CID 142686007) has the molecular formula C38H43FN6O4 and a molecular weight of 666.80 g/mol. Its IUPAC name is 4-[2-[3-(diaminomethylideneamino)propyl]-4-(2-naphthalen-2-ylethyl)-5-oxopiperazin-1-yl]-3-[(4-fluorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-4-oxobutanamide.
| Compound Name | 4-[2-[3-(diaminomethylideneamino)propyl]-4-(2-naphthalen-2-ylethyl)-5-oxopiperazin-1-yl]-3-[(4-fluorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 142686007 |
| Molecular Formula | C38H43FN6O4 |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | 4-[2-[3-(diaminomethylideneamino)propyl]-4-(2-naphthalen-2-ylethyl)-5-oxopiperazin-1-yl]-3-[(4-fluorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-4-oxobutanamide |
| SMILES | NC(=O)C(Cc1ccc(O)cc1)C(Cc1ccc(F)cc1)C(=O)N1CC(=O)N(CCc2ccc3ccccc3c2)CC1CCCN=C(N)N |
| InChI | InChI=1S/C38H43FN6O4/c39-30-13-8-25(9-14-30)22-34(33(36(40)48)21-26-10-15-32(46)16-11-26)37(49)45-24-35(47)44(23-31(45)6-3-18-43-38(41)42)19-17-27-7-12-28-4-1-2-5-29(28)20-27/h1-2,4-5,7-16,20,31,33-34,46H,3,6,17-19,21-24H2,(H2,40,48)(H4,41,42,43) |
| InChIKey | CRZDHURLJHECFI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 168.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|